C15H20O4 — CID 14903704
dimethyl (2Z)-bicyclo[6.2.1]undeca-1(11),2-diene-9,9-dicarboxylate (PubChem CID 14903704) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is dimethyl (2Z)-bicyclo[6.2.1]undeca-1(11),2-diene-9,9-dicarboxylate.
| Compound Name | dimethyl (2Z)-bicyclo[6.2.1]undeca-1(11),2-diene-9,9-dicarboxylate |
|---|---|
| PubChem CID | 14903704 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | dimethyl (2Z)-bicyclo[6.2.1]undeca-1(11),2-diene-9,9-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=CC1CCCC/C=C\2 |
| InChI | InChI=1S/C15H20O4/c1-18-13(16)15(14(17)19-2)10-11-7-5-3-4-6-8-12(15)9-11/h5,7,9,12H,3-4,6,8,10H2,1-2H3/b7-5- |
| InChIKey | KLIGEBNKOSHKJR-ALCCZGGFSA-N |
| XLogP | 2.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|