C20H30O4Si — CID 134981869
diethyl 7-methylidene-8-trimethylsilyl-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate (PubChem CID 134981869) has the molecular formula C20H30O4Si and a molecular weight of 362.54 g/mol. Its IUPAC name is diethyl 7-methylidene-8-trimethylsilyl-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 7-methylidene-8-trimethylsilyl-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134981869 |
| Molecular Formula | C20H30O4Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | diethyl 7-methylidene-8-trimethylsilyl-1,3,5,6-tetrahydronaphthalene-2,2-dicarboxylate |
| SMILES | C=C1CCC2=CCC(C(=O)OCC)(C(=O)OCC)CC2=C1[Si](C)(C)C |
| InChI | InChI=1S/C20H30O4Si/c1-7-23-18(21)20(19(22)24-8-2)12-11-15-10-9-14(3)17(16(15)13-20)25(4,5)6/h11H,3,7-10,12-13H2,1-2,4-6H3 |
| InChIKey | CBYJSJMBINODOJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|