C24H36O4 — CID 134981978
diethyl (5Z)-4-butyl-5-oct-3-yn-2-ylidenecyclohex-3-ene-1,1-dicarboxylate (PubChem CID 134981978) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is diethyl (5Z)-4-butyl-5-oct-3-yn-2-ylidenecyclohex-3-ene-1,1-dicarboxylate.
| Compound Name | diethyl (5Z)-4-butyl-5-oct-3-yn-2-ylidenecyclohex-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134981978 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | diethyl (5Z)-4-butyl-5-oct-3-yn-2-ylidenecyclohex-3-ene-1,1-dicarboxylate |
| SMILES | CCCCC#C/C(C)=C1/CC(C(=O)OCC)(C(=O)OCC)CC=C1CCCC |
| InChI | InChI=1S/C24H36O4/c1-6-10-12-13-14-19(5)21-18-24(22(25)27-8-3,23(26)28-9-4)17-16-20(21)15-11-7-2/h16H,6-12,15,17-18H2,1-5H3/b21-19- |
| InChIKey | BIKPFSYXDSMGKD-VZCXRCSSSA-N |
| XLogP | 5.52 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|