C23H36F2O4Si — CID 101186862
diethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate (PubChem CID 101186862) has the molecular formula C23H36F2O4Si and a molecular weight of 442.62 g/mol. Its IUPAC name is diethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate.
| Compound Name | diethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate |
|---|---|
| PubChem CID | 101186862 |
| Molecular Formula | C23H36F2O4Si |
| Molecular Weight | 442.62 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | diethyl 7,7-difluoro-5-tri(propan-2-yl)silylbicyclo[4.2.0]octa-1(8),5-diene-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC2=CC(F)(F)C2=C([Si](C(C)C)(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C23H36F2O4Si/c1-9-28-20(26)22(21(27)29-10-2)11-17-12-23(24,25)19(17)18(13-22)30(14(3)4,15(5)6)16(7)8/h12,14-16H,9-11,13H2,1-8H3 |
| InChIKey | XSPUXJZIGDKTSK-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.62 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|