C32H36Br2O8 — CID 10212239
2-[3,5-dibromo-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(3-methylbenzoyl)-5-propan-2-ylphenoxy]phenyl]acetic acid (PubChem CID 10212239) has the molecular formula C32H36Br2O8 and a molecular weight of 708.44 g/mol. Its IUPAC name is 2-[3,5-dibromo-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(3-methylbenzoyl)-5-propan-2-ylphenoxy]phenyl]acetic acid.
| Compound Name | 2-[3,5-dibromo-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(3-methylbenzoyl)-5-propan-2-ylphenoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 10212239 |
| Molecular Formula | C32H36Br2O8 |
| Molecular Weight | 708.44 g/mol |
| Exact Mass | 706.08 |
| IUPAC Name | 2-[3,5-dibromo-4-[4-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-2-(3-methylbenzoyl)-5-propan-2-ylphenoxy]phenyl]acetic acid |
| SMILES | COCCOCCOCCOc1cc(C(=O)c2cccc(C)c2)c(Oc2c(Br)cc(CC(=O)O)cc2Br)cc1C(C)C |
| InChI | InChI=1S/C32H36Br2O8/c1-20(2)24-18-29(42-32-26(33)15-22(16-27(32)34)17-30(35)36)25(31(37)23-7-5-6-21(3)14-23)19-28(24)41-13-12-40-11-10-39-9-8-38-4/h5-7,14-16,18-20H,8-13,17H2,1-4H3,(H,35,36) |
| InChIKey | AQUVZPHHIKNRQT-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.44 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|