About dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane
dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane (PubChem CID 102124150) has the molecular formula C31H34I4P2
and a molecular weight of 976.18 g/mol. Its IUPAC name is dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane.
Molecular Properties
| Compound Name | dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane |
| PubChem CID | 102124150 |
| Molecular Formula | C31H34I4P2 |
| Molecular Weight | 976.18 g/mol |
| Exact Mass | 975.83 |
| IUPAC Name | dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane |
| SMILES | IP(I)(CCCP(I)(I)(Cc1ccccc1)Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H34I4P2/c32-36(33,24-28-14-5-1-6-15-28,25-29-16-7-2-8-17-29)22-13-23-37(34,35,26-30-18-9-3-10-19-30)27-31-20-11-4-12-21-31/h1-12,14-21H,13,22-27H2 |
| InChIKey | TZSCUMBBWRCAHC-UHFFFAOYSA-N |
| XLogP | 12.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 976.18 |
| LogP ≤ 5 | 12.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane?
The IUPAC name of dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane (CID 102124150) is dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane.
What is the SMILES notation for dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane?
The canonical SMILES for dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane is IP(I)(CCCP(I)(I)(Cc1ccccc1)Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane?
The InChIKey is TZSCUMBBWRCAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H34I4P2/c32-36(33,24-28-14-5-1-6-15-28,25-29-16-7-2-8-17-29)22-13-23-37(34,35,26-30-18-9-3-10-19-30)27-31-20-11-4-12-21-31/h1-12,14-21H,13,22-27H2.
What are the key properties of dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane?
dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane has a molecular weight of 976.18 g/mol, XLogP of 12.68, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl-[3-[dibenzyl(diiodo)-λ5-phosphanyl]propyl]-diiodo-λ5-phosphane is sourced from PubChem (CID 102124150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).