C12H23NO12S3 — CID 102124231
[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy (1Z)-5-methylsulfonyl-N-sulfooxypentanimidothioate (PubChem CID 102124231) has the molecular formula C12H23NO12S3 and a molecular weight of 469.51 g/mol. Its IUPAC name is [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy (1Z)-5-methylsulfonyl-N-sulfooxypentanimidothioate.
| Compound Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy (1Z)-5-methylsulfonyl-N-sulfooxypentanimidothioate |
|---|---|
| PubChem CID | 102124231 |
| Molecular Formula | C12H23NO12S3 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy (1Z)-5-methylsulfonyl-N-sulfooxypentanimidothioate |
| SMILES | CS(=O)(=O)CCCC/C(=N/OS(=O)(=O)O)SO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO12S3/c1-27(18,19)5-3-2-4-8(13-25-28(20,21)22)26-24-12-11(17)10(16)9(15)7(6-14)23-12/h7,9-12,14-17H,2-6H2,1H3,(H,20,21,22)/b13-8-/t7-,9-,10+,11-,12+/m1/s1 |
| InChIKey | NTQOKDARPOTGBL-AHMUMSBHSA-N |
| XLogP | -2.20 |
| TPSA | 209.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | -2.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|