C23H22N2O6S — CID 102124778
2-(4-methylphenyl)sulfonyl-4-(4-nitrobenzoyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one (PubChem CID 102124778) has the molecular formula C23H22N2O6S and a molecular weight of 454.50 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-4-(4-nitrobenzoyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one.
| Compound Name | 2-(4-methylphenyl)sulfonyl-4-(4-nitrobenzoyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one |
|---|---|
| PubChem CID | 102124778 |
| Molecular Formula | C23H22N2O6S |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-4-(4-nitrobenzoyl)-1,3,4,5,6,7-hexahydroisoquinolin-8-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3=C(CCCC3=O)C(C(=O)c3ccc([N+](=O)[O-])cc3)C2)cc1 |
| InChI | InChI=1S/C23H22N2O6S/c1-15-5-11-18(12-6-15)32(30,31)24-13-20-19(3-2-4-22(20)26)21(14-24)23(27)16-7-9-17(10-8-16)25(28)29/h5-12,21H,2-4,13-14H2,1H3 |
| InChIKey | JPTJRILLJAVYCZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 114.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|