C17H20O2S — CID 102124799
9-ethylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one (PubChem CID 102124799) has the molecular formula C17H20O2S and a molecular weight of 288.41 g/mol. Its IUPAC name is 9-ethylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one.
| Compound Name | 9-ethylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
|---|---|
| PubChem CID | 102124799 |
| Molecular Formula | C17H20O2S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 9-ethylsulfanyl-3,3-dimethyl-4,9-dihydro-2H-xanthen-1-one |
| SMILES | CCSC1C2=C(CC(C)(C)CC2=O)Oc2ccccc21 |
| InChI | InChI=1S/C17H20O2S/c1-4-20-16-11-7-5-6-8-13(11)19-14-10-17(2,3)9-12(18)15(14)16/h5-8,16H,4,9-10H2,1-3H3 |
| InChIKey | KLATZPXLSOQXGA-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |