C10H13NO2 — CID 102126799
6-(hydroxymethyl)-6,7,8,9-tetrahydroquinolizin-4-one (PubChem CID 102126799) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 6-(hydroxymethyl)-6,7,8,9-tetrahydroquinolizin-4-one.
| Compound Name | 6-(hydroxymethyl)-6,7,8,9-tetrahydroquinolizin-4-one |
|---|---|
| PubChem CID | 102126799 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 6-(hydroxymethyl)-6,7,8,9-tetrahydroquinolizin-4-one |
| SMILES | O=c1cccc2n1C(CO)CCC2 |
| InChI | InChI=1S/C10H13NO2/c12-7-9-5-1-3-8-4-2-6-10(13)11(8)9/h2,4,6,9,12H,1,3,5,7H2 |
| InChIKey | UDYZXXVMKUAHGM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |