C10H15NO2 — CID 130149397
6-(hydroxymethyl)-3,6,7,8,9,9a-hexahydroquinolizin-4-one (PubChem CID 130149397) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 6-(hydroxymethyl)-3,6,7,8,9,9a-hexahydroquinolizin-4-one.
| Compound Name | 6-(hydroxymethyl)-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
|---|---|
| PubChem CID | 130149397 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 6-(hydroxymethyl)-3,6,7,8,9,9a-hexahydroquinolizin-4-one |
| SMILES | O=C1CC=CC2CCCC(CO)N12 |
| InChI | InChI=1S/C10H15NO2/c12-7-9-5-1-3-8-4-2-6-10(13)11(8)9/h2,4,8-9,12H,1,3,5-7H2 |
| InChIKey | DSSLCYHLFPFAJK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|