C20H19NO2S — CID 102127844
1-(benzenesulfonyl)-3-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]indole (PubChem CID 102127844) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]indole.
| Compound Name | 1-(benzenesulfonyl)-3-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]indole |
|---|---|
| PubChem CID | 102127844 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 1-(benzenesulfonyl)-3-methyl-2-[(1E)-3-methylbuta-1,3-dienyl]indole |
| SMILES | C=C(C)/C=C/c1c(C)c2ccccc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H19NO2S/c1-15(2)13-14-19-16(3)18-11-7-8-12-20(18)21(19)24(22,23)17-9-5-4-6-10-17/h4-14H,1H2,2-3H3/b14-13+ |
| InChIKey | NXKYTBJFTKMXON-BUHFOSPRSA-N |
| XLogP | 4.78 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|