C51H64O12Si — CID 102129055
methyl 3-[2,6-dimethoxy-3-[4-(2-methoxyethoxymethoxy)phenyl]-5-[4-tri(propan-2-yl)silyloxyphenyl]phenyl]-2,4-dimethoxy-5-[4-(methoxymethoxy)phenyl]benzoate (PubChem CID 102129055) has the molecular formula C51H64O12Si and a molecular weight of 897.15 g/mol. Its IUPAC name is methyl 3-[2,6-dimethoxy-3-[4-(2-methoxyethoxymethoxy)phenyl]-5-[4-tri(propan-2-yl)silyloxyphenyl]phenyl]-2,4-dimethoxy-5-[4-(methoxymethoxy)phenyl]benzoate.
| Compound Name | methyl 3-[2,6-dimethoxy-3-[4-(2-methoxyethoxymethoxy)phenyl]-5-[4-tri(propan-2-yl)silyloxyphenyl]phenyl]-2,4-dimethoxy-5-[4-(methoxymethoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 102129055 |
| Molecular Formula | C51H64O12Si |
| Molecular Weight | 897.15 g/mol |
| Exact Mass | 896.42 |
| IUPAC Name | methyl 3-[2,6-dimethoxy-3-[4-(2-methoxyethoxymethoxy)phenyl]-5-[4-tri(propan-2-yl)silyloxyphenyl]phenyl]-2,4-dimethoxy-5-[4-(methoxymethoxy)phenyl]benzoate |
| SMILES | COCCOCOc1ccc(-c2cc(-c3ccc(O[Si](C(C)C)(C(C)C)C(C)C)cc3)c(OC)c(-c3c(OC)c(C(=O)OC)cc(-c4ccc(OCOC)cc4)c3OC)c2OC)cc1 |
| InChI | InChI=1S/C51H64O12Si/c1-32(2)64(33(3)4,34(5)6)63-40-24-18-37(19-25-40)42-28-41(35-16-22-39(23-17-35)62-31-60-27-26-53-7)47(55-9)45(48(42)56-10)46-49(57-11)43(29-44(50(46)58-12)51(52)59-13)36-14-20-38(21-15-36)61-30-54-8/h14-25,28-29,32-34H,26-27,30-31H2,1-13H3 |
| InChIKey | YYZAQMOCWNYWAZ-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 118.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.15 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|