C24H14ClNO2 — CID 102129300
8-(4-chlorophenyl)-10-phenylpyrano[3,2-f]quinolin-3-one (PubChem CID 102129300) has the molecular formula C24H14ClNO2 and a molecular weight of 383.83 g/mol. Its IUPAC name is 8-(4-chlorophenyl)-10-phenylpyrano[3,2-f]quinolin-3-one.
| Compound Name | 8-(4-chlorophenyl)-10-phenylpyrano[3,2-f]quinolin-3-one |
|---|---|
| PubChem CID | 102129300 |
| Molecular Formula | C24H14ClNO2 |
| Molecular Weight | 383.83 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 8-(4-chlorophenyl)-10-phenylpyrano[3,2-f]quinolin-3-one |
| SMILES | O=c1ccc2c(ccc3nc(-c4ccc(Cl)cc4)cc(-c4ccccc4)c32)o1 |
| InChI | InChI=1S/C24H14ClNO2/c25-17-8-6-16(7-9-17)21-14-19(15-4-2-1-3-5-15)24-18-10-13-23(27)28-22(18)12-11-20(24)26-21/h1-14H |
| InChIKey | PQFUUXJDFATPKT-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.83 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|