C25H17ClN2O — CID 135017230
8-(3-chlorophenyl)-4-methyl-10-phenyl-4,7-phenanthrolin-3-one (PubChem CID 135017230) has the molecular formula C25H17ClN2O and a molecular weight of 396.88 g/mol. Its IUPAC name is 8-(3-chlorophenyl)-4-methyl-10-phenyl-4,7-phenanthrolin-3-one.
| Compound Name | 8-(3-chlorophenyl)-4-methyl-10-phenyl-4,7-phenanthrolin-3-one |
|---|---|
| PubChem CID | 135017230 |
| Molecular Formula | C25H17ClN2O |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 8-(3-chlorophenyl)-4-methyl-10-phenyl-4,7-phenanthrolin-3-one |
| SMILES | Cn1c(=O)ccc2c3c(-c4ccccc4)cc(-c4cccc(Cl)c4)nc3ccc21 |
| InChI | InChI=1S/C25H17ClN2O/c1-28-23-12-11-21-25(19(23)10-13-24(28)29)20(16-6-3-2-4-7-16)15-22(27-21)17-8-5-9-18(26)14-17/h2-15H,1H3 |
| InChIKey | ACNZYYMZUHCSNW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|