C25H19N3O — CID 135017697
4-ethyl-10-phenyl-8-pyridin-2-yl-4,7-phenanthrolin-3-one (PubChem CID 135017697) has the molecular formula C25H19N3O and a molecular weight of 377.45 g/mol. Its IUPAC name is 4-ethyl-10-phenyl-8-pyridin-2-yl-4,7-phenanthrolin-3-one.
| Compound Name | 4-ethyl-10-phenyl-8-pyridin-2-yl-4,7-phenanthrolin-3-one |
|---|---|
| PubChem CID | 135017697 |
| Molecular Formula | C25H19N3O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 4-ethyl-10-phenyl-8-pyridin-2-yl-4,7-phenanthrolin-3-one |
| SMILES | CCn1c(=O)ccc2c3c(-c4ccccc4)cc(-c4ccccn4)nc3ccc21 |
| InChI | InChI=1S/C25H19N3O/c1-2-28-23-13-12-21-25(18(23)11-14-24(28)29)19(17-8-4-3-5-9-17)16-22(27-21)20-10-6-7-15-26-20/h3-16H,2H2,1H3 |
| InChIKey | ZHQAUBIKPFSNBY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|