C18H14N2OS — CID 102105500
6-ethyl-2-phenyl-[1,3]thiazolo[5,4-f]quinolin-7-one (PubChem CID 102105500) has the molecular formula C18H14N2OS and a molecular weight of 306.39 g/mol. Its IUPAC name is 6-ethyl-2-phenyl-[1,3]thiazolo[5,4-f]quinolin-7-one.
| Compound Name | 6-ethyl-2-phenyl-[1,3]thiazolo[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 102105500 |
| Molecular Formula | C18H14N2OS |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 6-ethyl-2-phenyl-[1,3]thiazolo[5,4-f]quinolin-7-one |
| SMILES | CCn1c(=O)ccc2c3sc(-c4ccccc4)nc3ccc21 |
| InChI | InChI=1S/C18H14N2OS/c1-2-20-15-10-9-14-17(13(15)8-11-16(20)21)22-18(19-14)12-6-4-3-5-7-12/h3-11H,2H2,1H3 |
| InChIKey | HPBUTULFTMGMHI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |