C22H14N4 — CID 91243626
3,8-dipyridin-2-yl-4,7-phenanthroline (PubChem CID 91243626) has the molecular formula C22H14N4 and a molecular weight of 334.38 g/mol. Its IUPAC name is 3,8-dipyridin-2-yl-4,7-phenanthroline.
| Compound Name | 3,8-dipyridin-2-yl-4,7-phenanthroline |
|---|---|
| PubChem CID | 91243626 |
| Molecular Formula | C22H14N4 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 3,8-dipyridin-2-yl-4,7-phenanthroline |
| SMILES | c1ccc(-c2ccc3c(ccc4nc(-c5ccccn5)ccc43)n2)nc1 |
| InChI | InChI=1S/C22H14N4/c1-3-13-23-19(5-1)21-9-7-15-16-8-10-22(20-6-2-4-14-24-20)26-18(16)12-11-17(15)25-21/h1-14H |
| InChIKey | QTCFCKJFQWWEJK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|