C23H13ClN5Pt+ — CID 71543302
platinum(2+);6-pyridin-2-ylquinoxalino[2,3-f][1,10]phenanthroline;chloride (PubChem CID 71543302) has the molecular formula C23H13ClN5Pt+ and a molecular weight of 589.92 g/mol. Its IUPAC name is platinum(2+);6-pyridin-2-ylquinoxalino[2,3-f][1,10]phenanthroline;chloride.
| Compound Name | platinum(2+);6-pyridin-2-ylquinoxalino[2,3-f][1,10]phenanthroline;chloride |
|---|---|
| PubChem CID | 71543302 |
| Molecular Formula | C23H13ClN5Pt+ |
| Molecular Weight | 589.92 g/mol |
| Exact Mass | 589.05 |
| IUPAC Name | platinum(2+);6-pyridin-2-ylquinoxalino[2,3-f][1,10]phenanthroline;chloride |
| SMILES | [Cl-].[Pt+2].c1ccc(-c2ccc3c(n2)c2ncccc2c2nc4ccccc4nc32)nc1 |
| InChI | InChI=1S/C23H13N5.ClH.Pt/c1-2-9-18-17(8-1)26-22-14-6-5-13-25-20(14)21-15(23(22)27-18)10-11-19(28-21)16-7-3-4-12-24-16;;/h1-13H;1H;/q;;+2/p-1 |
| InChIKey | CBIGUQVZGIAWEO-UHFFFAOYSA-M |
| XLogP | 1.94 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.92 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|