C19H24O6 — CID 102129904
dimethyl (3aR)-6-(2,2-dimethylpropanoyloxy)-3,3a-dihydro-1H-azulene-2,2-dicarboxylate (PubChem CID 102129904) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is dimethyl (3aR)-6-(2,2-dimethylpropanoyloxy)-3,3a-dihydro-1H-azulene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR)-6-(2,2-dimethylpropanoyloxy)-3,3a-dihydro-1H-azulene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 102129904 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | dimethyl (3aR)-6-(2,2-dimethylpropanoyloxy)-3,3a-dihydro-1H-azulene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=CC=C(OC(=O)C(C)(C)C)C=C[C@H]2C1 |
| InChI | InChI=1S/C19H24O6/c1-18(2,3)15(20)25-14-8-6-12-10-19(16(21)23-4,17(22)24-5)11-13(12)7-9-14/h6-9,12H,10-11H2,1-5H3/t12-/m0/s1 |
| InChIKey | OJKISGKIPXTEBL-LBPRGKRZSA-N |
| XLogP | 2.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|