C25H16O — CID 102130163
(1S,14R)-hexacyclo[12.11.0.02,11.03,8.016,25.017,22]pentacosa-2(11),3,5,7,9,12,16(25),17,19,21,23-undecaen-15-one (PubChem CID 102130163) has the molecular formula C25H16O and a molecular weight of 332.40 g/mol. Its IUPAC name is (1S,14R)-hexacyclo[12.11.0.02,11.03,8.016,25.017,22]pentacosa-2(11),3,5,7,9,12,16(25),17,19,21,23-undecaen-15-one.
| Compound Name | (1S,14R)-hexacyclo[12.11.0.02,11.03,8.016,25.017,22]pentacosa-2(11),3,5,7,9,12,16(25),17,19,21,23-undecaen-15-one |
|---|---|
| PubChem CID | 102130163 |
| Molecular Formula | C25H16O |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | (1S,14R)-hexacyclo[12.11.0.02,11.03,8.016,25.017,22]pentacosa-2(11),3,5,7,9,12,16(25),17,19,21,23-undecaen-15-one |
| SMILES | O=C1c2c(ccc3ccccc23)[C@H]2c3c(ccc4ccccc34)C=C[C@@H]12 |
| InChI | InChI=1S/C25H16O/c26-25-21-14-12-17-10-9-15-5-1-3-7-18(15)22(17)23(21)20-13-11-16-6-2-4-8-19(16)24(20)25/h1-14,21,23H/t21-,23-/m1/s1 |
| InChIKey | LSDPOGZOEASSNR-FYYLOGMGSA-N |
| XLogP | 5.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |