C10H13N3O4S — CID 102130217
N-cyclohexyl-3,5-dinitrothiophen-2-amine (PubChem CID 102130217) has the molecular formula C10H13N3O4S and a molecular weight of 271.30 g/mol. Its IUPAC name is N-cyclohexyl-3,5-dinitrothiophen-2-amine.
| Compound Name | N-cyclohexyl-3,5-dinitrothiophen-2-amine |
|---|---|
| PubChem CID | 102130217 |
| Molecular Formula | C10H13N3O4S |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | N-cyclohexyl-3,5-dinitrothiophen-2-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(NC2CCCCC2)s1 |
| InChI | InChI=1S/C10H13N3O4S/c14-12(15)8-6-9(13(16)17)18-10(8)11-7-4-2-1-3-5-7/h6-7,11H,1-5H2 |
| InChIKey | HYLIERHWIPMTTR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|