C46H44N4O9 — CID 102130272
1-ethoxycarbonyloxyethyl 2-[3-methoxy-6-[3-[[2-oxo-2-(quinolin-8-ylamino)ethyl]-(pyridin-2-ylmethyl)amino]propoxy]-9H-xanthen-9-yl]benzoate (PubChem CID 102130272) has the molecular formula C46H44N4O9 and a molecular weight of 796.88 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 2-[3-methoxy-6-[3-[[2-oxo-2-(quinolin-8-ylamino)ethyl]-(pyridin-2-ylmethyl)amino]propoxy]-9H-xanthen-9-yl]benzoate.
| Compound Name | 1-ethoxycarbonyloxyethyl 2-[3-methoxy-6-[3-[[2-oxo-2-(quinolin-8-ylamino)ethyl]-(pyridin-2-ylmethyl)amino]propoxy]-9H-xanthen-9-yl]benzoate |
|---|---|
| PubChem CID | 102130272 |
| Molecular Formula | C46H44N4O9 |
| Molecular Weight | 796.88 g/mol |
| Exact Mass | 796.31 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 2-[3-methoxy-6-[3-[[2-oxo-2-(quinolin-8-ylamino)ethyl]-(pyridin-2-ylmethyl)amino]propoxy]-9H-xanthen-9-yl]benzoate |
| SMILES | CCOC(=O)OC(C)OC(=O)c1ccccc1C1c2ccc(OC)cc2Oc2cc(OCCCN(CC(=O)Nc3cccc4cccnc34)Cc3ccccn3)ccc21 |
| InChI | InChI=1S/C46H44N4O9/c1-4-55-46(53)58-30(2)57-45(52)36-16-6-5-15-35(36)43-37-20-18-33(54-3)26-40(37)59-41-27-34(19-21-38(41)43)56-25-11-24-50(28-32-14-7-8-22-47-32)29-42(51)49-39-17-9-12-31-13-10-23-48-44(31)39/h5-10,12-23,26-27,30,43H,4,11,24-25,28-29H2,1-3H3,(H,49,51) |
| InChIKey | GFLUSRWDNQYSQR-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.88 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|