C23H14INOS — CID 102130633
(1-iodo-2-phenylthieno[2,3-b]indol-4-yl)-phenylmethanone (PubChem CID 102130633) has the molecular formula C23H14INOS and a molecular weight of 479.34 g/mol. Its IUPAC name is (1-iodo-2-phenylthieno[2,3-b]indol-4-yl)-phenylmethanone.
| Compound Name | (1-iodo-2-phenylthieno[2,3-b]indol-4-yl)-phenylmethanone |
|---|---|
| PubChem CID | 102130633 |
| Molecular Formula | C23H14INOS |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.98 |
| IUPAC Name | (1-iodo-2-phenylthieno[2,3-b]indol-4-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)n1c2ccccc2c2c(I)c(-c3ccccc3)sc21 |
| InChI | InChI=1S/C23H14INOS/c24-20-19-17-13-7-8-14-18(17)25(22(26)16-11-5-2-6-12-16)23(19)27-21(20)15-9-3-1-4-10-15/h1-14H |
| InChIKey | SXKWDGJXFITJFJ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|