C13H9N3OS — CID 940372
4-acetyl-2-aminothieno[2,3-b]indole-1-carbonitrile (PubChem CID 940372) has the molecular formula C13H9N3OS and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-acetyl-2-aminothieno[2,3-b]indole-1-carbonitrile.
| Compound Name | 4-acetyl-2-aminothieno[2,3-b]indole-1-carbonitrile |
|---|---|
| PubChem CID | 940372 |
| Molecular Formula | C13H9N3OS |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-acetyl-2-aminothieno[2,3-b]indole-1-carbonitrile |
| SMILES | CC(=O)n1c2ccccc2c2c(C#N)c(N)sc21 |
| InChI | InChI=1S/C13H9N3OS/c1-7(17)16-10-5-3-2-4-8(10)11-9(6-14)12(15)18-13(11)16/h2-5H,15H2,1H3 |
| InChIKey | MWNDPTJQOFRWSV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |