C54H104N6O4 — CID 10213146
N,N'-bis[6-amino-1-[[(Z)-octadec-9-enyl]amino]-1-oxohexan-2-yl]hexanediamide (PubChem CID 10213146) has the molecular formula C54H104N6O4 and a molecular weight of 901.46 g/mol. Its IUPAC name is N,N'-bis[6-amino-1-[[(Z)-octadec-9-enyl]amino]-1-oxohexan-2-yl]hexanediamide.
| Compound Name | N,N'-bis[6-amino-1-[[(Z)-octadec-9-enyl]amino]-1-oxohexan-2-yl]hexanediamide |
|---|---|
| PubChem CID | 10213146 |
| Molecular Formula | C54H104N6O4 |
| Molecular Weight | 901.46 g/mol |
| Exact Mass | 900.81 |
| IUPAC Name | N,N'-bis[6-amino-1-[[(Z)-octadec-9-enyl]amino]-1-oxohexan-2-yl]hexanediamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCCNC(=O)C(CCCCN)NC(=O)CCCCC(=O)NC(CCCCN)C(=O)NCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C54H104N6O4/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-39-47-57-53(63)49(41-35-37-45-55)59-51(61)43-33-34-44-52(62)60-50(42-36-38-46-56)54(64)58-48-40-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20,49-50H,3-16,21-48,55-56H2,1-2H3,(H,57,63)(H,58,64)(H,59,61)(H,60,62)/b19-17-,20-18- |
| InChIKey | REQNEPXNMVWSAS-CLFAGFIQSA-N |
| XLogP | 12.08 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.46 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|