C15H16O2 — CID 102131579
(4S,11R)-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene (PubChem CID 102131579) has the molecular formula C15H16O2 and a molecular weight of 228.29 g/mol. Its IUPAC name is (4S,11R)-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene.
| Compound Name | (4S,11R)-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene |
|---|---|
| PubChem CID | 102131579 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (4S,11R)-3,12-dioxapentacyclo[12.2.1.04,16.05,10.011,15]heptadeca-5,7,9-triene |
| SMILES | c1ccc2c(c1)[C@H]1OCC3CC4CO[C@@H]2C4C31 |
| InChI | InChI=1S/C15H16O2/c1-2-4-11-10(3-1)14-12-8(6-16-14)5-9-7-17-15(11)13(9)12/h1-4,8-9,12-15H,5-7H2/t8?,9?,12?,13?,14-,15+ |
| InChIKey | PPLCPTGDGLSALB-CJERDHOWSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |