C28H42O3 — CID 102132219
(4R)-4-[(3Z,5S,7E,8R,9S,10S,13R,14S,17R)-3,7-di(ethylidene)-10,13-dimethyl-12-oxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 102132219) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is (4R)-4-[(3Z,5S,7E,8R,9S,10S,13R,14S,17R)-3,7-di(ethylidene)-10,13-dimethyl-12-oxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3Z,5S,7E,8R,9S,10S,13R,14S,17R)-3,7-di(ethylidene)-10,13-dimethyl-12-oxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 102132219 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | (4R)-4-[(3Z,5S,7E,8R,9S,10S,13R,14S,17R)-3,7-di(ethylidene)-10,13-dimethyl-12-oxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C/C=C1/CC[C@@]2(C)[C@@H](C1)C/C(=C\C)[C@@H]1[C@@H]2CC(=O)[C@]2(C)[C@@H]([C@H](C)CCC(=O)O)CC[C@@H]12 |
| InChI | InChI=1S/C28H42O3/c1-6-18-12-13-27(4)20(14-18)15-19(7-2)26-22-10-9-21(17(3)8-11-25(30)31)28(22,5)24(29)16-23(26)27/h6-7,17,20-23,26H,8-16H2,1-5H3,(H,30,31)/b18-6-,19-7+/t17-,20+,21-,22+,23+,26+,27+,28-/m1/s1 |
| InChIKey | RINIEXOMDWXVOR-SKHWVFRESA-N |
| XLogP | 6.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|