C22H21FN2 — CID 102133636
4-[(2S)-2-[fluoro(diphenyl)methyl]pyrrolidin-1-yl]pyridine (PubChem CID 102133636) has the molecular formula C22H21FN2 and a molecular weight of 332.42 g/mol. Its IUPAC name is 4-[(2S)-2-[fluoro(diphenyl)methyl]pyrrolidin-1-yl]pyridine.
| Compound Name | 4-[(2S)-2-[fluoro(diphenyl)methyl]pyrrolidin-1-yl]pyridine |
|---|---|
| PubChem CID | 102133636 |
| Molecular Formula | C22H21FN2 |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4-[(2S)-2-[fluoro(diphenyl)methyl]pyrrolidin-1-yl]pyridine |
| SMILES | FC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1c1ccncc1 |
| InChI | InChI=1S/C22H21FN2/c23-22(18-8-3-1-4-9-18,19-10-5-2-6-11-19)21-12-7-17-25(21)20-13-15-24-16-14-20/h1-6,8-11,13-16,21H,7,12,17H2/t21-/m0/s1 |
| InChIKey | OMEGOEHZPKDZLL-NRFANRHFSA-N |
| XLogP | 4.96 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |