C28H50O6 — CID 102135093
(5S,7R,9S,11E,14S)-5,7,9,11-tetramethyl-14-[(2R,3R,4S,5R,6R,7S)-3,5,7-trihydroxy-4,6-dimethylnonan-2-yl]-1-oxacyclotetradec-11-ene-2,4-dione (PubChem CID 102135093) has the molecular formula C28H50O6 and a molecular weight of 482.70 g/mol. Its IUPAC name is (5S,7R,9S,11E,14S)-5,7,9,11-tetramethyl-14-[(2R,3R,4S,5R,6R,7S)-3,5,7-trihydroxy-4,6-dimethylnonan-2-yl]-1-oxacyclotetradec-11-ene-2,4-dione.
| Compound Name | (5S,7R,9S,11E,14S)-5,7,9,11-tetramethyl-14-[(2R,3R,4S,5R,6R,7S)-3,5,7-trihydroxy-4,6-dimethylnonan-2-yl]-1-oxacyclotetradec-11-ene-2,4-dione |
|---|---|
| PubChem CID | 102135093 |
| Molecular Formula | C28H50O6 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | (5S,7R,9S,11E,14S)-5,7,9,11-tetramethyl-14-[(2R,3R,4S,5R,6R,7S)-3,5,7-trihydroxy-4,6-dimethylnonan-2-yl]-1-oxacyclotetradec-11-ene-2,4-dione |
| SMILES | CC[C@H](O)[C@@H](C)[C@@H](O)[C@H](C)[C@@H](O)[C@@H](C)[C@@H]1C/C=C(\C)C[C@@H](C)C[C@@H](C)C[C@H](C)C(=O)CC(=O)O1 |
| InChI | InChI=1S/C28H50O6/c1-9-23(29)20(6)27(32)22(8)28(33)21(7)25-11-10-16(2)12-17(3)13-18(4)14-19(5)24(30)15-26(31)34-25/h10,17-23,25,27-29,32-33H,9,11-15H2,1-8H3/b16-10+/t17-,18-,19+,20-,21+,22+,23+,25+,27-,28+/m1/s1 |
| InChIKey | KJKRQOTYPMAJRP-KNZJIETLSA-N |
| XLogP | 4.69 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|