C42H36O2S — CID 102135862
(3S,4S)-3,4-ditrityloxythiolane (PubChem CID 102135862) has the molecular formula C42H36O2S and a molecular weight of 604.82 g/mol. Its IUPAC name is (3S,4S)-3,4-ditrityloxythiolane.
| Compound Name | (3S,4S)-3,4-ditrityloxythiolane |
|---|---|
| PubChem CID | 102135862 |
| Molecular Formula | C42H36O2S |
| Molecular Weight | 604.82 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | (3S,4S)-3,4-ditrityloxythiolane |
| SMILES | c1ccc(C(O[C@@H]2CSC[C@H]2OC(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C42H36O2S/c1-7-19-33(20-8-1)41(34-21-9-2-10-22-34,35-23-11-3-12-24-35)43-39-31-45-32-40(39)44-42(36-25-13-4-14-26-36,37-27-15-5-16-28-37)38-29-17-6-18-30-38/h1-30,39-40H,31-32H2/t39-,40-/m1/s1 |
| InChIKey | QLNITVAEIIMQEX-XRSDMRJBSA-N |
| XLogP | 9.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.82 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|