C10H20O7P2 — CID 102137661
phosphono (2,4,4-trimethylcyclohexen-1-yl)methyl hydrogen phosphate (PubChem CID 102137661) has the molecular formula C10H20O7P2 and a molecular weight of 314.21 g/mol. Its IUPAC name is phosphono (2,4,4-trimethylcyclohexen-1-yl)methyl hydrogen phosphate.
| Compound Name | phosphono (2,4,4-trimethylcyclohexen-1-yl)methyl hydrogen phosphate |
|---|---|
| PubChem CID | 102137661 |
| Molecular Formula | C10H20O7P2 |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | phosphono (2,4,4-trimethylcyclohexen-1-yl)methyl hydrogen phosphate |
| SMILES | CC1=C(COP(=O)(O)OP(=O)(O)O)CCC(C)(C)C1 |
| InChI | InChI=1S/C10H20O7P2/c1-8-6-10(2,3)5-4-9(8)7-16-19(14,15)17-18(11,12)13/h4-7H2,1-3H3,(H,14,15)(H2,11,12,13) |
| InChIKey | QOQNHEGRZYNCJV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|