C28H22O6 — CID 102138997
3-[2-(3-carboxyphenyl)-1,2-dihydroxy-1,2-diphenylethyl]benzoic acid (PubChem CID 102138997) has the molecular formula C28H22O6 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-[2-(3-carboxyphenyl)-1,2-dihydroxy-1,2-diphenylethyl]benzoic acid.
| Compound Name | 3-[2-(3-carboxyphenyl)-1,2-dihydroxy-1,2-diphenylethyl]benzoic acid |
|---|---|
| PubChem CID | 102138997 |
| Molecular Formula | C28H22O6 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 3-[2-(3-carboxyphenyl)-1,2-dihydroxy-1,2-diphenylethyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(O)(c2ccccc2)C(O)(c2ccccc2)c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C28H22O6/c29-25(30)19-9-7-15-23(17-19)27(33,21-11-3-1-4-12-21)28(34,22-13-5-2-6-14-22)24-16-8-10-20(18-24)26(31)32/h1-18,33-34H,(H,29,30)(H,31,32) |
| InChIKey | IDGAYJTXXSIMQV-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |