C11H22O6P2 — CID 102139241
3,9-dipropyl-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide (PubChem CID 102139241) has the molecular formula C11H22O6P2 and a molecular weight of 312.24 g/mol. Its IUPAC name is 3,9-dipropyl-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide.
| Compound Name | 3,9-dipropyl-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
|---|---|
| PubChem CID | 102139241 |
| Molecular Formula | C11H22O6P2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 3,9-dipropyl-2,4,8,10-tetraoxa-3λ5,9λ5-diphosphaspiro[5.5]undecane 3,9-dioxide |
| SMILES | CCCP1(=O)OCC2(CO1)COP(=O)(CCC)OC2 |
| InChI | InChI=1S/C11H22O6P2/c1-3-5-18(12)14-7-11(8-15-18)9-16-19(13,6-4-2)17-10-11/h3-10H2,1-2H3 |
| InChIKey | WUMGWWXRAPTZBU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|