C20H24N2O2 — CID 102140208
prop-2-enyl N-[(1S,2R)-2-amino-1,2-bis(3-methylphenyl)ethyl]carbamate (PubChem CID 102140208) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is prop-2-enyl N-[(1S,2R)-2-amino-1,2-bis(3-methylphenyl)ethyl]carbamate.
| Compound Name | prop-2-enyl N-[(1S,2R)-2-amino-1,2-bis(3-methylphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 102140208 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | prop-2-enyl N-[(1S,2R)-2-amino-1,2-bis(3-methylphenyl)ethyl]carbamate |
| SMILES | C=CCOC(=O)N[C@@H](c1cccc(C)c1)[C@H](N)c1cccc(C)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-4-11-24-20(23)22-19(17-10-6-8-15(3)13-17)18(21)16-9-5-7-14(2)12-16/h4-10,12-13,18-19H,1,11,21H2,2-3H3,(H,22,23)/t18-,19+/m1/s1 |
| InChIKey | FCBZNANOUXCNRK-MOPGFXCFSA-N |
| XLogP | 3.96 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|