C8H13NOS — CID 102140395
(7aS)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-5-thione (PubChem CID 102140395) has the molecular formula C8H13NOS and a molecular weight of 171.26 g/mol. Its IUPAC name is (7aS)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-5-thione.
| Compound Name | (7aS)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-5-thione |
|---|---|
| PubChem CID | 102140395 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | (7aS)-3,3-dimethyl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-5-thione |
| SMILES | CC1(C)OC[C@@H]2CCC(=S)N21 |
| InChI | InChI=1S/C8H13NOS/c1-8(2)9-6(5-10-8)3-4-7(9)11/h6H,3-5H2,1-2H3/t6-/m0/s1 |
| InChIKey | MBGCLBHOPLGTCF-LURJTMIESA-N |
| XLogP | 1.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|