C6H9NOS — CID 588541
5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-3-thione (PubChem CID 588541) has the molecular formula C6H9NOS and a molecular weight of 143.21 g/mol. Its IUPAC name is 5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-3-thione.
| Compound Name | 5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-3-thione |
|---|---|
| PubChem CID | 588541 |
| Molecular Formula | C6H9NOS |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | 5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole-3-thione |
| SMILES | S=C1OCC2CCCN12 |
| InChI | InChI=1S/C6H9NOS/c9-6-7-3-1-2-5(7)4-8-6/h5H,1-4H2 |
| InChIKey | BRMQFGYQMYLGBN-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|