C6H11NO — CID 100962291
(7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole (PubChem CID 100962291) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is (7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 100962291 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | (7aS)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole |
| SMILES | C1C[C@H]2COCN2C1 |
| InChI | InChI=1S/C6H11NO/c1-2-6-4-8-5-7(6)3-1/h6H,1-5H2/t6-/m0/s1 |
| InChIKey | ZSBBPZQTWOPHRB-LURJTMIESA-N |
| XLogP | 0.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |