C7H10F3NO — CID 101130581
(3R,7aS)-3-(trifluoromethyl)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole (PubChem CID 101130581) has the molecular formula C7H10F3NO and a molecular weight of 181.16 g/mol. Its IUPAC name is (3R,7aS)-3-(trifluoromethyl)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (3R,7aS)-3-(trifluoromethyl)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 101130581 |
| Molecular Formula | C7H10F3NO |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (3R,7aS)-3-(trifluoromethyl)-1,3,5,6,7,7a-hexahydropyrrolo[1,2-c][1,3]oxazole |
| SMILES | FC(F)(F)[C@H]1OC[C@@H]2CCCN21 |
| InChI | InChI=1S/C7H10F3NO/c8-7(9,10)6-11-3-1-2-5(11)4-12-6/h5-6H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | KLFMRRGFOVQXDI-NTSWFWBYSA-N |
| XLogP | 1.37 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |