C9H15F2NO — CID 141470020
(6S,7R,7aS)-6-fluoro-7-(fluoromethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 141470020) has the molecular formula C9H15F2NO and a molecular weight of 191.22 g/mol. Its IUPAC name is (6S,7R,7aS)-6-fluoro-7-(fluoromethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (6S,7R,7aS)-6-fluoro-7-(fluoromethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 141470020 |
| Molecular Formula | C9H15F2NO |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (6S,7R,7aS)-6-fluoro-7-(fluoromethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | CC1(C)OC[C@@H]2[C@H](CF)[C@H](F)CN21 |
| InChI | InChI=1S/C9H15F2NO/c1-9(2)12-4-7(11)6(3-10)8(12)5-13-9/h6-8H,3-5H2,1-2H3/t6-,7-,8-/m1/s1 |
| InChIKey | NGFKLBMCAORDKU-BWZBUEFSSA-N |
| XLogP | 1.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |