C10H16FNO — CID 151461262
6-fluoro-3,3-dimethylspiro[1,5,6,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-7,1'-cyclopropane] (PubChem CID 151461262) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is 6-fluoro-3,3-dimethylspiro[1,5,6,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-7,1'-cyclopropane].
| Compound Name | 6-fluoro-3,3-dimethylspiro[1,5,6,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-7,1'-cyclopropane] |
|---|---|
| PubChem CID | 151461262 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 6-fluoro-3,3-dimethylspiro[1,5,6,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-7,1'-cyclopropane] |
| SMILES | CC1(C)OCC2N1CC(F)C21CC1 |
| InChI | InChI=1S/C10H16FNO/c1-9(2)12-5-7(11)10(3-4-10)8(12)6-13-9/h7-8H,3-6H2,1-2H3 |
| InChIKey | PIMWRQWKKMLOMI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |