C10H17F2NO — CID 141470039
(6R,7S,7aS)-6-fluoro-7-(2-fluoroethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 141470039) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is (6R,7S,7aS)-6-fluoro-7-(2-fluoroethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (6R,7S,7aS)-6-fluoro-7-(2-fluoroethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 141470039 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (6R,7S,7aS)-6-fluoro-7-(2-fluoroethyl)-3,3-dimethyl-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | CC1(C)OC[C@@H]2[C@H](CCF)[C@@H](F)CN21 |
| InChI | InChI=1S/C10H17F2NO/c1-10(2)13-5-8(12)7(3-4-11)9(13)6-14-10/h7-9H,3-6H2,1-2H3/t7-,8+,9-/m1/s1 |
| InChIKey | CVCPGOXBUOLQTF-HRDYMLBCSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |