C8H12F3NO2 — CID 102253563
(3R,7aR)-7a-methoxy-3-(trifluoromethyl)-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 102253563) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is (3R,7aR)-7a-methoxy-3-(trifluoromethyl)-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (3R,7aR)-7a-methoxy-3-(trifluoromethyl)-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 102253563 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | (3R,7aR)-7a-methoxy-3-(trifluoromethyl)-3,5,6,7-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | CO[C@@]12CCCN1[C@@H](C(F)(F)F)OC2 |
| InChI | InChI=1S/C8H12F3NO2/c1-13-7-3-2-4-12(7)6(14-5-7)8(9,10)11/h6H,2-5H2,1H3/t6-,7-/m1/s1 |
| InChIKey | XPTUMUUMWLEELB-RNFRBKRXSA-N |
| XLogP | 1.34 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |