C56H64O10 — CID 102142303
bis(3-decoxycarbonyl-5-hydroxyphenyl) 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxylate (PubChem CID 102142303) has the molecular formula C56H64O10 and a molecular weight of 897.12 g/mol. Its IUPAC name is bis(3-decoxycarbonyl-5-hydroxyphenyl) 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxylate.
| Compound Name | bis(3-decoxycarbonyl-5-hydroxyphenyl) 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxylate |
|---|---|
| PubChem CID | 102142303 |
| Molecular Formula | C56H64O10 |
| Molecular Weight | 897.12 g/mol |
| Exact Mass | 896.45 |
| IUPAC Name | bis(3-decoxycarbonyl-5-hydroxyphenyl) 1,12-dimethylbenzo[c]phenanthrene-5,8-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1cc(O)cc(OC(=O)c2cc3cc(C(=O)Oc4cc(O)cc(C(=O)OCCCCCCCCCC)c4)c4cccc(C)c4c3c3c(C)cccc23)c1 |
| InChI | InChI=1S/C56H64O10/c1-5-7-9-11-13-15-17-19-27-63-53(59)40-29-42(57)35-44(31-40)65-55(61)48-33-39-34-49(47-26-22-24-38(4)51(47)52(39)50-37(3)23-21-25-46(48)50)56(62)66-45-32-41(30-43(58)36-45)54(60)64-28-20-18-16-14-12-10-8-6-2/h21-26,29-36,57-58H,5-20,27-28H2,1-4H3 |
| InChIKey | BONPDDROHVBQNP-UHFFFAOYSA-N |
| XLogP | 14.21 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.12 |
| LogP ≤ 5 | 14.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|