C19H34O5Si — CID 102143484
dimethyl 2-[(E)-6-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]cyclopropane-1,1-dicarboxylate (PubChem CID 102143484) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is dimethyl 2-[(E)-6-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-[(E)-6-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102143484 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | dimethyl 2-[(E)-6-[tert-butyl(dimethyl)silyl]oxyhex-1-enyl]cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1/C=C/CCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H34O5Si/c1-18(2,3)25(6,7)24-13-11-9-8-10-12-15-14-19(15,16(20)22-4)17(21)23-5/h10,12,15H,8-9,11,13-14H2,1-7H3/b12-10+ |
| InChIKey | QMMWWIWPTHOQQC-ZRDIBKRKSA-N |
| XLogP | 4.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|