C18H19N3O3 — CID 102143547
(E)-3-(3,4-dihydroxyphenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one (PubChem CID 102143547) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is (E)-3-(3,4-dihydroxyphenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dihydroxyphenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 102143547 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | (E)-3-(3,4-dihydroxyphenyl)-1-(4-pyridin-2-ylpiperazin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H19N3O3/c22-15-6-4-14(13-16(15)23)5-7-18(24)21-11-9-20(10-12-21)17-3-1-2-8-19-17/h1-8,13,22-23H,9-12H2/b7-5+ |
| InChIKey | KWBIYHURSGPOAP-FNORWQNLSA-N |
| XLogP | 1.85 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|