C38H46O2S4 — CID 102143568
S-[5-[2-[4-[2-(5-acetylsulfanyl-3,4-dibutylthiophen-2-yl)ethynyl]phenyl]ethynyl]-3,4-dibutylthiophen-2-yl] ethanethioate (PubChem CID 102143568) has the molecular formula C38H46O2S4 and a molecular weight of 663.05 g/mol. Its IUPAC name is S-[5-[2-[4-[2-(5-acetylsulfanyl-3,4-dibutylthiophen-2-yl)ethynyl]phenyl]ethynyl]-3,4-dibutylthiophen-2-yl] ethanethioate.
| Compound Name | S-[5-[2-[4-[2-(5-acetylsulfanyl-3,4-dibutylthiophen-2-yl)ethynyl]phenyl]ethynyl]-3,4-dibutylthiophen-2-yl] ethanethioate |
|---|---|
| PubChem CID | 102143568 |
| Molecular Formula | C38H46O2S4 |
| Molecular Weight | 663.05 g/mol |
| Exact Mass | 662.24 |
| IUPAC Name | S-[5-[2-[4-[2-(5-acetylsulfanyl-3,4-dibutylthiophen-2-yl)ethynyl]phenyl]ethynyl]-3,4-dibutylthiophen-2-yl] ethanethioate |
| SMILES | CCCCc1c(C#Cc2ccc(C#Cc3sc(SC(C)=O)c(CCCC)c3CCCC)cc2)sc(SC(C)=O)c1CCCC |
| InChI | InChI=1S/C38H46O2S4/c1-7-11-15-31-33(17-13-9-3)37(41-27(5)39)43-35(31)25-23-29-19-21-30(22-20-29)24-26-36-32(16-12-8-2)34(18-14-10-4)38(44-36)42-28(6)40/h19-22H,7-18H2,1-6H3 |
| InChIKey | WIPZNJDJRADEPA-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.05 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|