C38H56S3Si2 — CID 101244955
2-[3,4-dibutyl-5-[5-[3,4-dibutyl-5-(2-trimethylsilylethynyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane (PubChem CID 101244955) has the molecular formula C38H56S3Si2 and a molecular weight of 665.24 g/mol. Its IUPAC name is 2-[3,4-dibutyl-5-[5-[3,4-dibutyl-5-(2-trimethylsilylethynyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,4-dibutyl-5-[5-[3,4-dibutyl-5-(2-trimethylsilylethynyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 101244955 |
| Molecular Formula | C38H56S3Si2 |
| Molecular Weight | 665.24 g/mol |
| Exact Mass | 664.31 |
| IUPAC Name | 2-[3,4-dibutyl-5-[5-[3,4-dibutyl-5-(2-trimethylsilylethynyl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethynyl-trimethylsilane |
| SMILES | CCCCc1c(C#C[Si](C)(C)C)sc(-c2ccc(-c3sc(C#C[Si](C)(C)C)c(CCCC)c3CCCC)s2)c1CCCC |
| InChI | InChI=1S/C38H56S3Si2/c1-11-15-19-29-31(21-17-13-3)37(40-33(29)25-27-42(5,6)7)35-23-24-36(39-35)38-32(22-18-14-4)30(20-16-12-2)34(41-38)26-28-43(8,9)10/h23-24H,11-22H2,1-10H3 |
| InChIKey | KBRXBKXERPHMGU-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.24 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|