C28H47NO7Si — CID 102143688
benzyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[tert-butyl(dimethyl)silyl]oxypentanoate (PubChem CID 102143688) has the molecular formula C28H47NO7Si and a molecular weight of 537.77 g/mol. Its IUPAC name is benzyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[tert-butyl(dimethyl)silyl]oxypentanoate.
| Compound Name | benzyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[tert-butyl(dimethyl)silyl]oxypentanoate |
|---|---|
| PubChem CID | 102143688 |
| Molecular Formula | C28H47NO7Si |
| Molecular Weight | 537.77 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | benzyl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-5-[tert-butyl(dimethyl)silyl]oxypentanoate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)[C@@H](CCCO[Si](C)(C)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H47NO7Si/c1-26(2,3)35-24(31)29(25(32)36-27(4,5)6)22(18-15-19-34-37(10,11)28(7,8)9)23(30)33-20-21-16-13-12-14-17-21/h12-14,16-17,22H,15,18-20H2,1-11H3/t22-/m0/s1 |
| InChIKey | OXZTVTFUQWLSEC-QFIPXVFZSA-N |
| XLogP | 7.07 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|