C23H34FNO6 — CID 138964425
benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-4-methylpentanoate (PubChem CID 138964425) has the molecular formula C23H34FNO6 and a molecular weight of 439.52 g/mol. Its IUPAC name is benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-4-methylpentanoate.
| Compound Name | benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-4-methylpentanoate |
|---|---|
| PubChem CID | 138964425 |
| Molecular Formula | C23H34FNO6 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | benzyl 2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-2-fluoro-4-methylpentanoate |
| SMILES | CC(C)CC(F)(C(=O)OCc1ccccc1)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34FNO6/c1-16(2)14-23(24,18(26)29-15-17-12-10-9-11-13-17)25(19(27)30-21(3,4)5)20(28)31-22(6,7)8/h9-13,16H,14-15H2,1-8H3 |
| InChIKey | PUGWPPLNBTYIAW-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|